C11H17N5O — CID 113411675
3-[(5-aminopyrazin-2-yl)amino]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 113411675) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 3-[(5-aminopyrazin-2-yl)amino]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 3-[(5-aminopyrazin-2-yl)amino]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 113411675 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 3-[(5-aminopyrazin-2-yl)amino]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | Nc1cnc(NCCC(=O)N2CCCC2)cn1 |
| InChI | InChI=1S/C11H17N5O/c12-9-7-15-10(8-14-9)13-4-3-11(17)16-5-1-2-6-16/h7-8H,1-6H2,(H2,12,14)(H,13,15) |
| InChIKey | KIMHEUVWLJPPMT-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |