C12H17BrN2OS — CID 113412084
5-bromo-N-[(3-methylpiperidin-3-yl)methyl]thiophene-3-carboxamide (PubChem CID 113412084) has the molecular formula C12H17BrN2OS and a molecular weight of 317.25 g/mol. Its IUPAC name is 5-bromo-N-[(3-methylpiperidin-3-yl)methyl]thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-[(3-methylpiperidin-3-yl)methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 113412084 |
| Molecular Formula | C12H17BrN2OS |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 5-bromo-N-[(3-methylpiperidin-3-yl)methyl]thiophene-3-carboxamide |
| SMILES | CC1(CNC(=O)c2csc(Br)c2)CCCNC1 |
| InChI | InChI=1S/C12H17BrN2OS/c1-12(3-2-4-14-7-12)8-15-11(16)9-5-10(13)17-6-9/h5-6,14H,2-4,7-8H2,1H3,(H,15,16) |
| InChIKey | SNQWBHDLSIRPOE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |