C10H13N5OS — CID 113412359
4-amino-5-methyl-N-[2-(triazol-1-yl)ethyl]thiophene-2-carboxamide (PubChem CID 113412359) has the molecular formula C10H13N5OS and a molecular weight of 251.31 g/mol. Its IUPAC name is 4-amino-5-methyl-N-[2-(triazol-1-yl)ethyl]thiophene-2-carboxamide.
| Compound Name | 4-amino-5-methyl-N-[2-(triazol-1-yl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 113412359 |
| Molecular Formula | C10H13N5OS |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 4-amino-5-methyl-N-[2-(triazol-1-yl)ethyl]thiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)NCCn2ccnn2)cc1N |
| InChI | InChI=1S/C10H13N5OS/c1-7-8(11)6-9(17-7)10(16)12-2-4-15-5-3-13-14-15/h3,5-6H,2,4,11H2,1H3,(H,12,16) |
| InChIKey | CWCNPGIPBOUXDP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |