C25H23Cl2N3O5 — CID 11341303
3-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxy-N-[[3-(1-oxidopyridin-1-ium-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzamide (PubChem CID 11341303) has the molecular formula C25H23Cl2N3O5 and a molecular weight of 516.38 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxy-N-[[3-(1-oxidopyridin-1-ium-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzamide.
| Compound Name | 3-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxy-N-[[3-(1-oxidopyridin-1-ium-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 11341303 |
| Molecular Formula | C25H23Cl2N3O5 |
| Molecular Weight | 516.38 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | 3-[2-(2,4-dichlorophenyl)ethoxy]-4-methoxy-N-[[3-(1-oxidopyridin-1-ium-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]benzamide |
| SMILES | COc1ccc(C(=O)NCC2CC(c3cc[n+]([O-])cc3)=NO2)cc1OCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H23Cl2N3O5/c1-33-23-5-3-18(12-24(23)34-11-8-16-2-4-19(26)13-21(16)27)25(31)28-15-20-14-22(29-35-20)17-6-9-30(32)10-7-17/h2-7,9-10,12-13,20H,8,11,14-15H2,1H3,(H,28,31) |
| InChIKey | SWXCFUKUNYIBGW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|