C12H14Br2N4 — CID 113413629
2-[4-(3,5-dibromo-2-pyridinyl)piperazin-1-yl]propanenitrile (PubChem CID 113413629) has the molecular formula C12H14Br2N4 and a molecular weight of 374.08 g/mol. Its IUPAC name is 2-[4-(3,5-dibromo-2-pyridinyl)piperazin-1-yl]propanenitrile.
| Compound Name | 2-[4-(3,5-dibromo-2-pyridinyl)piperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 113413629 |
| Molecular Formula | C12H14Br2N4 |
| Molecular Weight | 374.08 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | 2-[4-(3,5-dibromo-2-pyridinyl)piperazin-1-yl]propanenitrile |
| SMILES | CC(C#N)N1CCN(c2ncc(Br)cc2Br)CC1 |
| InChI | InChI=1S/C12H14Br2N4/c1-9(7-15)17-2-4-18(5-3-17)12-11(14)6-10(13)8-16-12/h6,8-9H,2-5H2,1H3 |
| InChIKey | MJHKHGZPBDGYSA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.08 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |