C14H14Br2N2O — CID 113413693
3,5-dibromo-N-(3-phenoxypropyl)pyridin-2-amine (PubChem CID 113413693) has the molecular formula C14H14Br2N2O and a molecular weight of 386.09 g/mol. Its IUPAC name is 3,5-dibromo-N-(3-phenoxypropyl)pyridin-2-amine.
| Compound Name | 3,5-dibromo-N-(3-phenoxypropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 113413693 |
| Molecular Formula | C14H14Br2N2O |
| Molecular Weight | 386.09 g/mol |
| Exact Mass | 383.95 |
| IUPAC Name | 3,5-dibromo-N-(3-phenoxypropyl)pyridin-2-amine |
| SMILES | Brc1cnc(NCCCOc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C14H14Br2N2O/c15-11-9-13(16)14(18-10-11)17-7-4-8-19-12-5-2-1-3-6-12/h1-3,5-6,9-10H,4,7-8H2,(H,17,18) |
| InChIKey | BWHTWQMVDKDSGH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.09 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|