C27H36N4O2 — CID 11341394
2-[4-[6-oxo-6-(1,2,3,4-tetrahydronaphthalen-1-ylamino)hexyl]piperazin-1-yl]benzamide (PubChem CID 11341394) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 2-[4-[6-oxo-6-(1,2,3,4-tetrahydronaphthalen-1-ylamino)hexyl]piperazin-1-yl]benzamide.
| Compound Name | 2-[4-[6-oxo-6-(1,2,3,4-tetrahydronaphthalen-1-ylamino)hexyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 11341394 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 2-[4-[6-oxo-6-(1,2,3,4-tetrahydronaphthalen-1-ylamino)hexyl]piperazin-1-yl]benzamide |
| SMILES | NC(=O)c1ccccc1N1CCN(CCCCCC(=O)NC2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C27H36N4O2/c28-27(33)23-12-5-6-14-25(23)31-19-17-30(18-20-31)16-7-1-2-15-26(32)29-24-13-8-10-21-9-3-4-11-22(21)24/h3-6,9,11-12,14,24H,1-2,7-8,10,13,15-20H2,(H2,28,33)(H,29,32) |
| InChIKey | CUNIRIUQESLLLU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|