C26H39N3O8 — CID 11341397
tert-butyl N-[(2S)-5-methoxy-1-[(4S,5R)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-1-oxopentan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 11341397) has the molecular formula C26H39N3O8 and a molecular weight of 521.61 g/mol. Its IUPAC name is tert-butyl N-[(2S)-5-methoxy-1-[(4S,5R)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-1-oxopentan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-[(2S)-5-methoxy-1-[(4S,5R)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-1-oxopentan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 11341397 |
| Molecular Formula | C26H39N3O8 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | tert-butyl N-[(2S)-5-methoxy-1-[(4S,5R)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-1-oxopentan-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | COCCC[C@@H](C(=O)N1C(=O)O[C@H](c2ccccc2)[C@@H]1C)N(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H39N3O8/c1-17-20(18-13-10-9-11-14-18)35-23(32)28(17)21(30)19(15-12-16-34-8)29(24(33)37-26(5,6)7)27-22(31)36-25(2,3)4/h9-11,13-14,17,19-20H,12,15-16H2,1-8H3,(H,27,31)/t17-,19-,20-/m0/s1 |
| InChIKey | ZJBZXNINOJLFGE-IHPCNDPISA-N |
| XLogP | 4.57 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|