C14H17NO4 — CID 113414185
methyl 6-[(4-oxocyclohexyl)oxymethyl]pyridine-3-carboxylate (PubChem CID 113414185) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl 6-[(4-oxocyclohexyl)oxymethyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[(4-oxocyclohexyl)oxymethyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 113414185 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl 6-[(4-oxocyclohexyl)oxymethyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(COC2CCC(=O)CC2)nc1 |
| InChI | InChI=1S/C14H17NO4/c1-18-14(17)10-2-3-11(15-8-10)9-19-13-6-4-12(16)5-7-13/h2-3,8,13H,4-7,9H2,1H3 |
| InChIKey | GEEHRGQNXWZTNX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |