C24H36N2O9Si — CID 11341443
dimethyl (8R,9S,10S,12S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-hydroxy-6-(methoxymethoxy)-14-oxa-1,11-diazatetracyclo[7.4.1.02,7.010,12]tetradeca-2(7),3,5-triene-4,11-dicarboxylate (PubChem CID 11341443) has the molecular formula C24H36N2O9Si and a molecular weight of 524.64 g/mol. Its IUPAC name is dimethyl (8R,9S,10S,12S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-hydroxy-6-(methoxymethoxy)-14-oxa-1,11-diazatetracyclo[7.4.1.02,7.010,12]tetradeca-2(7),3,5-triene-4,11-dicarboxylate.
| Compound Name | dimethyl (8R,9S,10S,12S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-hydroxy-6-(methoxymethoxy)-14-oxa-1,11-diazatetracyclo[7.4.1.02,7.010,12]tetradeca-2(7),3,5-triene-4,11-dicarboxylate |
|---|---|
| PubChem CID | 11341443 |
| Molecular Formula | C24H36N2O9Si |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | dimethyl (8R,9S,10S,12S)-8-[[tert-butyl(dimethyl)silyl]oxymethyl]-9-hydroxy-6-(methoxymethoxy)-14-oxa-1,11-diazatetracyclo[7.4.1.02,7.010,12]tetradeca-2(7),3,5-triene-4,11-dicarboxylate |
| SMILES | COCOc1cc(C(=O)OC)cc2c1[C@H](CO[Si](C)(C)C(C)(C)C)[C@]1(O)ON2C[C@H]2[C@@H]1N2C(=O)OC |
| InChI | InChI=1S/C24H36N2O9Si/c1-23(2,3)36(7,8)34-12-15-19-16(9-14(21(27)31-5)10-18(19)33-13-30-4)25-11-17-20(24(15,29)35-25)26(17)22(28)32-6/h9-10,15,17,20,29H,11-13H2,1-8H3/t15-,17-,20-,24-,26?/m0/s1 |
| InChIKey | DXLQHFIXSGAYHB-BHGAJFDVSA-N |
| XLogP | 2.83 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|