C14H30N2O — CID 113414453
1-(aminomethyl)-4-methoxy-N-methyl-N-pentan-2-ylcyclohexan-1-amine (PubChem CID 113414453) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is 1-(aminomethyl)-4-methoxy-N-methyl-N-pentan-2-ylcyclohexan-1-amine.
| Compound Name | 1-(aminomethyl)-4-methoxy-N-methyl-N-pentan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 113414453 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 1-(aminomethyl)-4-methoxy-N-methyl-N-pentan-2-ylcyclohexan-1-amine |
| SMILES | CCCC(C)N(C)C1(CN)CCC(OC)CC1 |
| InChI | InChI=1S/C14H30N2O/c1-5-6-12(2)16(3)14(11-15)9-7-13(17-4)8-10-14/h12-13H,5-11,15H2,1-4H3 |
| InChIKey | KTZSBQPFYHFHHS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |