C13H17N5 — CID 113414758
3-(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)pyrazine-2-carbonitrile (PubChem CID 113414758) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)pyrazine-2-carbonitrile.
| Compound Name | 3-(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 113414758 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 3-(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1N1CC2CCCC(N)C2C1 |
| InChI | InChI=1S/C13H17N5/c14-6-12-13(17-5-4-16-12)18-7-9-2-1-3-11(15)10(9)8-18/h4-5,9-11H,1-3,7-8,15H2 |
| InChIKey | GZCHNTLNRFIUDX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |