C11H15N3O3 — CID 113414919
(E)-N'-(5-methoxy-2-nitrophenyl)but-2-ene-1,4-diamine (PubChem CID 113414919) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is (E)-N'-(5-methoxy-2-nitrophenyl)but-2-ene-1,4-diamine.
| Compound Name | (E)-N'-(5-methoxy-2-nitrophenyl)but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 113414919 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | (E)-N'-(5-methoxy-2-nitrophenyl)but-2-ene-1,4-diamine |
| SMILES | COc1ccc([N+](=O)[O-])c(NC/C=C/CN)c1 |
| InChI | InChI=1S/C11H15N3O3/c1-17-9-4-5-11(14(15)16)10(8-9)13-7-3-2-6-12/h2-5,8,13H,6-7,12H2,1H3/b3-2+ |
| InChIKey | DPNJPAAPCWEEIG-NSCUHMNNSA-N |
| XLogP | 1.53 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|