C14H18N4 — CID 113414930
2-[[(E)-4-aminobut-2-enyl]amino]-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 113414930) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is 2-[[(E)-4-aminobut-2-enyl]amino]-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-[[(E)-4-aminobut-2-enyl]amino]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 113414930 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 2-[[(E)-4-aminobut-2-enyl]amino]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | N#Cc1cc2c(nc1NC/C=C/CN)CCCC2 |
| InChI | InChI=1S/C14H18N4/c15-7-3-4-8-17-14-12(10-16)9-11-5-1-2-6-13(11)18-14/h3-4,9H,1-2,5-8,15H2,(H,17,18)/b4-3+ |
| InChIKey | GHNOFHZVHJRZAE-ONEGZZNKSA-N |
| XLogP | 1.76 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|