C23H40F3N3O7 — CID 11341498
(E,4S)-4-[[(2S)-2-[[(2S)-3-hydroxy-3-methyl-2-(methylamino)butanoyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid;2,2,2-trifluoroacetic acid (PubChem CID 11341498) has the molecular formula C23H40F3N3O7 and a molecular weight of 527.58 g/mol. Its IUPAC name is (E,4S)-4-[[(2S)-2-[[(2S)-3-hydroxy-3-methyl-2-(methylamino)butanoyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (E,4S)-4-[[(2S)-2-[[(2S)-3-hydroxy-3-methyl-2-(methylamino)butanoyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11341498 |
| Molecular Formula | C23H40F3N3O7 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | (E,4S)-4-[[(2S)-2-[[(2S)-3-hydroxy-3-methyl-2-(methylamino)butanoyl]amino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CN[C@H](C(=O)N[C@H](C(=O)N(C)[C@H](/C=C(\C)C(=O)O)C(C)C)C(C)(C)C)C(C)(C)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H39N3O5.C2HF3O2/c1-12(2)14(11-13(3)19(27)28)24(10)18(26)16(20(4,5)6)23-17(25)15(22-9)21(7,8)29;3-2(4,5)1(6)7/h11-12,14-16,22,29H,1-10H3,(H,23,25)(H,27,28);(H,6,7)/b13-11+;/t14-,15-,16-;/m1./s1 |
| InChIKey | ZHEGUOKOWLJWPY-PGRBICGPSA-N |
| XLogP | 2.02 |
| TPSA | 156.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|