C24H22ClFN6O3S — CID 11341530
N-[4-(2-amino-2-oxoethyl)sulfanyl-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzamide (PubChem CID 11341530) has the molecular formula C24H22ClFN6O3S and a molecular weight of 529.00 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)sulfanyl-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)sulfanyl-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 11341530 |
| Molecular Formula | C24H22ClFN6O3S |
| Molecular Weight | 529.00 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)sulfanyl-2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]-4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(SCC(N)=O)cc2C(=O)Nc2ccc(Cl)cn2)c(F)c1)N(C)C |
| InChI | InChI=1S/C24H22ClFN6O3S/c1-32(2)22(28)13-3-6-16(18(26)9-13)23(34)30-19-7-5-15(36-12-20(27)33)10-17(19)24(35)31-21-8-4-14(25)11-29-21/h3-11,28H,12H2,1-2H3,(H2,27,33)(H,30,34)(H,29,31,35)/b28-22- |
| InChIKey | LBZKKHFELVZWEF-SLMZUGIISA-N |
| XLogP | 3.84 |
| TPSA | 141.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.00 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|