C30H33N3S3 — CID 11341583
2-[[3,5-bis[(2-aminophenyl)sulfanylmethyl]-2,4,6-trimethylphenyl]methylsulfanyl]aniline (PubChem CID 11341583) has the molecular formula C30H33N3S3 and a molecular weight of 531.82 g/mol. Its IUPAC name is 2-[[3,5-bis[(2-aminophenyl)sulfanylmethyl]-2,4,6-trimethylphenyl]methylsulfanyl]aniline.
| Compound Name | 2-[[3,5-bis[(2-aminophenyl)sulfanylmethyl]-2,4,6-trimethylphenyl]methylsulfanyl]aniline |
|---|---|
| PubChem CID | 11341583 |
| Molecular Formula | C30H33N3S3 |
| Molecular Weight | 531.82 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 2-[[3,5-bis[(2-aminophenyl)sulfanylmethyl]-2,4,6-trimethylphenyl]methylsulfanyl]aniline |
| SMILES | Cc1c(CSc2ccccc2N)c(C)c(CSc2ccccc2N)c(C)c1CSc1ccccc1N |
| InChI | InChI=1S/C30H33N3S3/c1-19-22(16-34-28-13-7-4-10-25(28)31)20(2)24(18-36-30-15-9-6-12-27(30)33)21(3)23(19)17-35-29-14-8-5-11-26(29)32/h4-15H,16-18,31-33H2,1-3H3 |
| InChIKey | AFLJAQLKKGPKOX-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.82 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|