C15H18ClNO2 — CID 113418200
(E)-3-[3-chloro-4-(3-ethylpyrrolidin-1-yl)phenyl]prop-2-enoic acid (PubChem CID 113418200) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-(3-ethylpyrrolidin-1-yl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-chloro-4-(3-ethylpyrrolidin-1-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 113418200 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (E)-3-[3-chloro-4-(3-ethylpyrrolidin-1-yl)phenyl]prop-2-enoic acid |
| SMILES | CCC1CCN(c2ccc(/C=C/C(=O)O)cc2Cl)C1 |
| InChI | InChI=1S/C15H18ClNO2/c1-2-11-7-8-17(10-11)14-5-3-12(9-13(14)16)4-6-15(18)19/h3-6,9,11H,2,7-8,10H2,1H3,(H,18,19)/b6-4+ |
| InChIKey | LSZIGICLHLQPBI-GQCTYLIASA-N |
| XLogP | 3.67 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|