C32H52O6Si — CID 11341986
[(E,2R,3S)-1,2-dihydroxy-5-methyl-6-[(2S,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]hex-5-en-3-yl] (2E,4Z)-7-[tert-butyl(dimethyl)silyl]oxy-5-methylnona-2,4,8-trienoate (PubChem CID 11341986) has the molecular formula C32H52O6Si and a molecular weight of 560.85 g/mol. Its IUPAC name is [(E,2R,3S)-1,2-dihydroxy-5-methyl-6-[(2S,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]hex-5-en-3-yl] (2E,4Z)-7-[tert-butyl(dimethyl)silyl]oxy-5-methylnona-2,4,8-trienoate.
| Compound Name | [(E,2R,3S)-1,2-dihydroxy-5-methyl-6-[(2S,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]hex-5-en-3-yl] (2E,4Z)-7-[tert-butyl(dimethyl)silyl]oxy-5-methylnona-2,4,8-trienoate |
|---|---|
| PubChem CID | 11341986 |
| Molecular Formula | C32H52O6Si |
| Molecular Weight | 560.85 g/mol |
| Exact Mass | 560.35 |
| IUPAC Name | [(E,2R,3S)-1,2-dihydroxy-5-methyl-6-[(2S,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]hex-5-en-3-yl] (2E,4Z)-7-[tert-butyl(dimethyl)silyl]oxy-5-methylnona-2,4,8-trienoate |
| SMILES | C=CC[C@H]1CC(=C)C[C@@H](/C=C(\C)C[C@H](OC(=O)/C=C/C=C(/C)CC(C=C)O[Si](C)(C)C(C)(C)C)[C@H](O)CO)O1 |
| InChI | InChI=1S/C32H52O6Si/c1-11-14-27-18-24(4)19-28(36-27)20-25(5)21-30(29(34)22-33)37-31(35)16-13-15-23(3)17-26(12-2)38-39(9,10)32(6,7)8/h11-13,15-16,20,26-30,33-34H,1-2,4,14,17-19,21-22H2,3,5-10H3/b16-13+,23-15-,25-20+/t26?,27-,28-,29+,30-/m0/s1 |
| InChIKey | DYYMMJHUSKGXML-OWXPGQIZSA-N |
| XLogP | 6.74 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.85 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|