C28H36O12 — CID 11342037
[(1S,2R,3S,4S,5R,8S,9R,10R,12Z,14S,17R)-2,5,9-triacetyloxy-4-hydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-10-yl] acetate (PubChem CID 11342037) has the molecular formula C28H36O12 and a molecular weight of 564.58 g/mol. Its IUPAC name is [(1S,2R,3S,4S,5R,8S,9R,10R,12Z,14S,17R)-2,5,9-triacetyloxy-4-hydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-10-yl] acetate.
| Compound Name | [(1S,2R,3S,4S,5R,8S,9R,10R,12Z,14S,17R)-2,5,9-triacetyloxy-4-hydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-10-yl] acetate |
|---|---|
| PubChem CID | 11342037 |
| Molecular Formula | C28H36O12 |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | [(1S,2R,3S,4S,5R,8S,9R,10R,12Z,14S,17R)-2,5,9-triacetyloxy-4-hydroxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-6,12-dien-10-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2[C@](C)(O)[C@H](OC(C)=O)C=C[C@]2(C)[C@@H](OC(C)=O)[C@H](OC(C)=O)C/C(C)=C\[C@@H]2OC(=O)[C@]3(C)O[C@@]213 |
| InChI | InChI=1S/C28H36O12/c1-13-11-18(35-14(2)29)22(37-16(4)31)25(6)10-9-19(36-15(3)30)26(7,34)21(25)23(38-17(5)32)28-20(12-13)39-24(33)27(28,8)40-28/h9-10,12,18-23,34H,11H2,1-8H3/b13-12-/t18-,19-,20+,21-,22+,23-,25+,26-,27+,28+/m1/s1 |
| InChIKey | WHOHBNAPLIHMRD-SJGVTVIUSA-N |
| XLogP | 1.46 |
| TPSA | 164.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|