C12H9Br2F3N2 — CID 113420796
4-(bromomethyl)-1-(4-bromo-2-methylphenyl)-5-(trifluoromethyl)pyrazole (PubChem CID 113420796) has the molecular formula C12H9Br2F3N2 and a molecular weight of 398.02 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(4-bromo-2-methylphenyl)-5-(trifluoromethyl)pyrazole.
| Compound Name | 4-(bromomethyl)-1-(4-bromo-2-methylphenyl)-5-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 113420796 |
| Molecular Formula | C12H9Br2F3N2 |
| Molecular Weight | 398.02 g/mol |
| Exact Mass | 395.91 |
| IUPAC Name | 4-(bromomethyl)-1-(4-bromo-2-methylphenyl)-5-(trifluoromethyl)pyrazole |
| SMILES | Cc1cc(Br)ccc1-n1ncc(CBr)c1C(F)(F)F |
| InChI | InChI=1S/C12H9Br2F3N2/c1-7-4-9(14)2-3-10(7)19-11(12(15,16)17)8(5-13)6-18-19/h2-4,6H,5H2,1H3 |
| InChIKey | UTXLRSOQLDJGHC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.02 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|