About [2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-yl]methanol
[2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-yl]methanol (PubChem CID 113420920) has the molecular formula C12H19F3O3
and a molecular weight of 268.27 g/mol. Its IUPAC name is [2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-yl]methanol.
Molecular Properties
| Compound Name | [2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-yl]methanol |
| PubChem CID | 113420920 |
| Molecular Formula | C12H19F3O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | [2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-yl]methanol |
| SMILES | OCC1(CCOCC(F)(F)F)CCOC1C1CC1 |
| InChI | InChI=1S/C12H19F3O3/c13-12(14,15)8-17-5-3-11(7-16)4-6-18-10(11)9-1-2-9/h9-10,16H,1-8H2 |
| InChIKey | AZSVWTLFXZWKHG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-yl]methanol?
The IUPAC name of [2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-yl]methanol (CID 113420920) is [2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-yl]methanol.
What is the SMILES notation for [2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-yl]methanol?
The canonical SMILES for [2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-yl]methanol is OCC1(CCOCC(F)(F)F)CCOC1C1CC1.
What is the InChIKey of [2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-yl]methanol?
The InChIKey is AZSVWTLFXZWKHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F3O3/c13-12(14,15)8-17-5-3-11(7-16)4-6-18-10(11)9-1-2-9/h9-10,16H,1-8H2.
What are the key properties of [2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-yl]methanol?
[2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-yl]methanol has a molecular weight of 268.27 g/mol, XLogP of 2.13, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-cyclopropyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]oxolan-3-yl]methanol is sourced from PubChem (CID 113420920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).