About CID 11342105
CID 11342105 (PubChem CID 11342105) has the molecular formula C12H10N
and a molecular weight of 168.22 g/mol.
Molecular Properties
| Compound Name | CID 11342105 |
| PubChem CID | 11342105 |
| Molecular Formula | C12H10N |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][CH][C](/N=C/c2ccccc2)[CH]1 |
| InChI | InChI=1S/C12H10N/c1-2-6-11(7-3-1)10-13-12-8-4-5-9-12/h1-10H/b13-10+ |
| InChIKey | CYCIOVCEJWEDGX-JLHYYAGUSA-N |
| XLogP | 2.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 11342105 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11342105?
The IUPAC name of CID 11342105 (CID 11342105) is not available.
What is the SMILES notation for CID 11342105?
The canonical SMILES for CID 11342105 is [CH]1[CH][CH][C](/N=C/c2ccccc2)[CH]1.
What is the InChIKey of CID 11342105?
The InChIKey is CYCIOVCEJWEDGX-JLHYYAGUSA-N. The full InChI is InChI=1S/C12H10N/c1-2-6-11(7-3-1)10-13-12-8-4-5-9-12/h1-10H/b13-10+.
What are the key properties of CID 11342105?
CID 11342105 has a molecular weight of 168.22 g/mol, XLogP of 2.47, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11342105 is sourced from PubChem (CID 11342105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).