C11H7Cl2N3O2 — CID 113421518
(3,5-dichloro-2-pyridinyl)-(3-methoxypyrazin-2-yl)methanone (PubChem CID 113421518) has the molecular formula C11H7Cl2N3O2 and a molecular weight of 284.10 g/mol. Its IUPAC name is (3,5-dichloro-2-pyridinyl)-(3-methoxypyrazin-2-yl)methanone.
| Compound Name | (3,5-dichloro-2-pyridinyl)-(3-methoxypyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 113421518 |
| Molecular Formula | C11H7Cl2N3O2 |
| Molecular Weight | 284.10 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | (3,5-dichloro-2-pyridinyl)-(3-methoxypyrazin-2-yl)methanone |
| SMILES | COc1nccnc1C(=O)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C11H7Cl2N3O2/c1-18-11-9(14-2-3-15-11)10(17)8-7(13)4-6(12)5-16-8/h2-5H,1H3 |
| InChIKey | JCATZEUFIRHICV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.10 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |