C10H18N2O3S2 — CID 113422081
N-(1-amino-1-sulfanylidenepropan-2-yl)-N-methyl-1,1-dioxothiane-2-carboxamide (PubChem CID 113422081) has the molecular formula C10H18N2O3S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-(1-amino-1-sulfanylidenepropan-2-yl)-N-methyl-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-(1-amino-1-sulfanylidenepropan-2-yl)-N-methyl-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 113422081 |
| Molecular Formula | C10H18N2O3S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | N-(1-amino-1-sulfanylidenepropan-2-yl)-N-methyl-1,1-dioxothiane-2-carboxamide |
| SMILES | CC(C(N)=S)N(C)C(=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C10H18N2O3S2/c1-7(9(11)16)12(2)10(13)8-5-3-4-6-17(8,14)15/h7-8H,3-6H2,1-2H3,(H2,11,16) |
| InChIKey | BOPWAGXNZHNLSE-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|