C12H15BrN2O3S — CID 113422106
N-(5-bromo-4-methyl-2-pyridinyl)-1,1-dioxothiane-2-carboxamide (PubChem CID 113422106) has the molecular formula C12H15BrN2O3S and a molecular weight of 347.23 g/mol. Its IUPAC name is N-(5-bromo-4-methyl-2-pyridinyl)-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-(5-bromo-4-methyl-2-pyridinyl)-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 113422106 |
| Molecular Formula | C12H15BrN2O3S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | N-(5-bromo-4-methyl-2-pyridinyl)-1,1-dioxothiane-2-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CCCCS2(=O)=O)ncc1Br |
| InChI | InChI=1S/C12H15BrN2O3S/c1-8-6-11(14-7-9(8)13)15-12(16)10-4-2-3-5-19(10,17)18/h6-7,10H,2-5H2,1H3,(H,14,15,16) |
| InChIKey | ALSXCINWJIBNJQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |