About 3-(1,1-dioxothian-2-yl)-4-(2-methylpropyl)-1,2-oxazol-5-amine
3-(1,1-dioxothian-2-yl)-4-(2-methylpropyl)-1,2-oxazol-5-amine (PubChem CID 113422169) has the molecular formula C12H20N2O3S
and a molecular weight of 272.37 g/mol. Its IUPAC name is 3-(1,1-dioxothian-2-yl)-4-(2-methylpropyl)-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | 3-(1,1-dioxothian-2-yl)-4-(2-methylpropyl)-1,2-oxazol-5-amine |
| PubChem CID | 113422169 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 3-(1,1-dioxothian-2-yl)-4-(2-methylpropyl)-1,2-oxazol-5-amine |
| SMILES | CC(C)Cc1c(C2CCCCS2(=O)=O)noc1N |
| InChI | InChI=1S/C12H20N2O3S/c1-8(2)7-9-11(14-17-12(9)13)10-5-3-4-6-18(10,15)16/h8,10H,3-7,13H2,1-2H3 |
| InChIKey | XNKYQPQAZHKQPB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1,1-dioxothian-2-yl)-4-(2-methylpropyl)-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-dioxothian-2-yl)-4-(2-methylpropyl)-1,2-oxazol-5-amine?
The IUPAC name of 3-(1,1-dioxothian-2-yl)-4-(2-methylpropyl)-1,2-oxazol-5-amine (CID 113422169) is 3-(1,1-dioxothian-2-yl)-4-(2-methylpropyl)-1,2-oxazol-5-amine.
What is the SMILES notation for 3-(1,1-dioxothian-2-yl)-4-(2-methylpropyl)-1,2-oxazol-5-amine?
The canonical SMILES for 3-(1,1-dioxothian-2-yl)-4-(2-methylpropyl)-1,2-oxazol-5-amine is CC(C)Cc1c(C2CCCCS2(=O)=O)noc1N.
What is the InChIKey of 3-(1,1-dioxothian-2-yl)-4-(2-methylpropyl)-1,2-oxazol-5-amine?
The InChIKey is XNKYQPQAZHKQPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O3S/c1-8(2)7-9-11(14-17-12(9)13)10-5-3-4-6-18(10,15)16/h8,10H,3-7,13H2,1-2H3.
What are the key properties of 3-(1,1-dioxothian-2-yl)-4-(2-methylpropyl)-1,2-oxazol-5-amine?
3-(1,1-dioxothian-2-yl)-4-(2-methylpropyl)-1,2-oxazol-5-amine has a molecular weight of 272.37 g/mol, XLogP of 2.10, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxothian-2-yl)-4-(2-methylpropyl)-1,2-oxazol-5-amine is sourced from PubChem (CID 113422169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).