C29H23F3N4O4S — CID 11342235
1-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-3-[4-[(3,4,5-trifluorophenyl)methylsulfamoyl]phenyl]urea (PubChem CID 11342235) has the molecular formula C29H23F3N4O4S and a molecular weight of 580.59 g/mol. Its IUPAC name is 1-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-3-[4-[(3,4,5-trifluorophenyl)methylsulfamoyl]phenyl]urea.
| Compound Name | 1-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-3-[4-[(3,4,5-trifluorophenyl)methylsulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 11342235 |
| Molecular Formula | C29H23F3N4O4S |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | 1-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]-3-[4-[(3,4,5-trifluorophenyl)methylsulfamoyl]phenyl]urea |
| SMILES | O=C(Nc1ccc(C2=N[C@H](c3ccccc3)CO2)cc1)Nc1ccc(S(=O)(=O)NCc2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C29H23F3N4O4S/c30-24-14-18(15-25(31)27(24)32)16-33-41(38,39)23-12-10-22(11-13-23)35-29(37)34-21-8-6-20(7-9-21)28-36-26(17-40-28)19-4-2-1-3-5-19/h1-15,26,33H,16-17H2,(H2,34,35,37)/t26-/m0/s1 |
| InChIKey | XSYHFIRIEVXLOZ-SANMLTNESA-N |
| XLogP | 5.74 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|