C36H37O4PS — CID 11342393
[(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 11342393) has the molecular formula C36H37O4PS and a molecular weight of 596.73 g/mol. Its IUPAC name is [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 11342393 |
| Molecular Formula | C36H37O4PS |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | [(1R,2S,4S)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | CC1(C)[C@H]2CC[C@]1(CS(=O)(=O)c1ccccc1)[C@@H](OC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C36H37O4PS/c1-35(2)28-23-24-36(35,27-42(38,39)32-21-13-6-14-22-32)33(25-28)40-34(37)26-41(29-15-7-3-8-16-29,30-17-9-4-10-18-30)31-19-11-5-12-20-31/h3-22,26,28,33H,23-25,27H2,1-2H3/t28-,33-,36-/m0/s1 |
| InChIKey | PIXGIKVYOPXVRF-XVVMYKDKSA-N |
| XLogP | 5.99 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|