C37H48N2O5 — CID 11342423
3-hydroxy-2-[[4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoyl]amino]propanoic acid (PubChem CID 11342423) has the molecular formula C37H48N2O5 and a molecular weight of 600.80 g/mol. Its IUPAC name is 3-hydroxy-2-[[4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-hydroxy-2-[[4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 11342423 |
| Molecular Formula | C37H48N2O5 |
| Molecular Weight | 600.80 g/mol |
| Exact Mass | 600.36 |
| IUPAC Name | 3-hydroxy-2-[[4-[4-[4-(propan-2-ylamino)butoxy]-3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]benzoyl]amino]propanoic acid |
| SMILES | CC(C)NCCCCOc1ccc(-c2ccc(C(=O)NC(CO)C(=O)O)cc2)cc1-c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C37H48N2O5/c1-24(2)38-19-7-8-20-44-33-16-14-27(25-9-11-26(12-10-25)34(41)39-32(23-40)35(42)43)21-29(33)28-13-15-30-31(22-28)37(5,6)18-17-36(30,3)4/h9-16,21-22,24,32,38,40H,7-8,17-20,23H2,1-6H3,(H,39,41)(H,42,43) |
| InChIKey | UVUHDHZSDUTPOZ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.80 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|