About 4-[(E)-2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethenyl]-1,3-thiazol-2-amine
4-[(E)-2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethenyl]-1,3-thiazol-2-amine (PubChem CID 113425009) has the molecular formula C13H11BrN2OS
and a molecular weight of 323.22 g/mol. Its IUPAC name is 4-[(E)-2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethenyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-[(E)-2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethenyl]-1,3-thiazol-2-amine |
| PubChem CID | 113425009 |
| Molecular Formula | C13H11BrN2OS |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 4-[(E)-2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethenyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(/C=C/c2cc(Br)cc3c2OCC3)cs1 |
| InChI | InChI=1S/C13H11BrN2OS/c14-10-5-8(12-9(6-10)3-4-17-12)1-2-11-7-18-13(15)16-11/h1-2,5-7H,3-4H2,(H2,15,16)/b2-1+ |
| InChIKey | VDXCLXBAVMRAJM-OWOJBTEDSA-N |
| XLogP | 3.59 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(E)-2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethenyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethenyl]-1,3-thiazol-2-amine?
The IUPAC name of 4-[(E)-2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethenyl]-1,3-thiazol-2-amine (CID 113425009) is 4-[(E)-2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethenyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 4-[(E)-2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethenyl]-1,3-thiazol-2-amine?
The canonical SMILES for 4-[(E)-2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethenyl]-1,3-thiazol-2-amine is Nc1nc(/C=C/c2cc(Br)cc3c2OCC3)cs1.
What is the InChIKey of 4-[(E)-2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethenyl]-1,3-thiazol-2-amine?
The InChIKey is VDXCLXBAVMRAJM-OWOJBTEDSA-N. The full InChI is InChI=1S/C13H11BrN2OS/c14-10-5-8(12-9(6-10)3-4-17-12)1-2-11-7-18-13(15)16-11/h1-2,5-7H,3-4H2,(H2,15,16)/b2-1+.
What are the key properties of 4-[(E)-2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethenyl]-1,3-thiazol-2-amine?
4-[(E)-2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethenyl]-1,3-thiazol-2-amine has a molecular weight of 323.22 g/mol, XLogP of 3.59, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)ethenyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 113425009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).