C26H36F6O10 — CID 11342582
[(2S,3S,4S,6R)-2-methyl-6-[4-[(2R,4S,5S,6S)-6-methyl-5-prop-2-enoxy-4-(2,2,2-trifluoroacetyl)oxyoxan-2-yl]oxybutoxy]-3-prop-2-enoxyoxan-4-yl] 2,2,2-trifluoroacetate (PubChem CID 11342582) has the molecular formula C26H36F6O10 and a molecular weight of 622.55 g/mol. Its IUPAC name is [(2S,3S,4S,6R)-2-methyl-6-[4-[(2R,4S,5S,6S)-6-methyl-5-prop-2-enoxy-4-(2,2,2-trifluoroacetyl)oxyoxan-2-yl]oxybutoxy]-3-prop-2-enoxyoxan-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2S,3S,4S,6R)-2-methyl-6-[4-[(2R,4S,5S,6S)-6-methyl-5-prop-2-enoxy-4-(2,2,2-trifluoroacetyl)oxyoxan-2-yl]oxybutoxy]-3-prop-2-enoxyoxan-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11342582 |
| Molecular Formula | C26H36F6O10 |
| Molecular Weight | 622.55 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | [(2S,3S,4S,6R)-2-methyl-6-[4-[(2R,4S,5S,6S)-6-methyl-5-prop-2-enoxy-4-(2,2,2-trifluoroacetyl)oxyoxan-2-yl]oxybutoxy]-3-prop-2-enoxyoxan-4-yl] 2,2,2-trifluoroacetate |
| SMILES | C=CCO[C@H]1[C@H](C)O[C@@H](OCCCCO[C@H]2C[C@H](OC(=O)C(F)(F)F)[C@@H](OCC=C)[C@H](C)O2)C[C@@H]1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C26H36F6O10/c1-5-9-37-21-15(3)39-19(13-17(21)41-23(33)25(27,28)29)35-11-7-8-12-36-20-14-18(42-24(34)26(30,31)32)22(16(4)40-20)38-10-6-2/h5-6,15-22H,1-2,7-14H2,3-4H3/t15-,16-,17-,18-,19+,20+,21-,22-/m0/s1 |
| InChIKey | LDAVOZUSDKYKTM-CLPXVCJBSA-N |
| XLogP | 4.16 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|