C38H52O6Si — CID 11342644
ethyl (3R)-4-[(2R,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]oxan-2-yl]-3-hydroxybutanoate (PubChem CID 11342644) has the molecular formula C38H52O6Si and a molecular weight of 632.91 g/mol. Its IUPAC name is ethyl (3R)-4-[(2R,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]oxan-2-yl]-3-hydroxybutanoate.
| Compound Name | ethyl (3R)-4-[(2R,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]oxan-2-yl]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 11342644 |
| Molecular Formula | C38H52O6Si |
| Molecular Weight | 632.91 g/mol |
| Exact Mass | 632.35 |
| IUPAC Name | ethyl (3R)-4-[(2R,6S)-6-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-4-phenylmethoxybutyl]oxan-2-yl]-3-hydroxybutanoate |
| SMILES | CCOC(=O)C[C@H](O)C[C@H]1CCC[C@@H](C[C@H](CCOCc2ccccc2)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C38H52O6Si/c1-5-42-37(40)27-31(39)26-32-18-15-19-33(43-32)28-34(24-25-41-29-30-16-9-6-10-17-30)44-45(38(2,3)4,35-20-11-7-12-21-35)36-22-13-8-14-23-36/h6-14,16-17,20-23,31-34,39H,5,15,18-19,24-29H2,1-4H3/t31-,32-,33+,34+/m1/s1 |
| InChIKey | VXJIYWSFRAROEZ-WZJLIZBTSA-N |
| XLogP | 6.57 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.91 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|