C17H15BrN2 — CID 1134278
(1S)-1-(2-bromophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 1134278) has the molecular formula C17H15BrN2 and a molecular weight of 327.22 g/mol. Its IUPAC name is (1S)-1-(2-bromophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | (1S)-1-(2-bromophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 1134278 |
| Molecular Formula | C17H15BrN2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | (1S)-1-(2-bromophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | Brc1ccccc1[C@@H]1NCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C17H15BrN2/c18-14-7-3-1-6-13(14)16-17-12(9-10-19-16)11-5-2-4-8-15(11)20-17/h1-8,16,19-20H,9-10H2/t16-/m0/s1 |
| InChIKey | DJFBBNZOXCQBNF-INIZCTEOSA-N |
| XLogP | 4.17 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|