About 3,5-dichloro-4-(3,5-dioxothiomorpholin-4-yl)benzoic acid
3,5-dichloro-4-(3,5-dioxothiomorpholin-4-yl)benzoic acid (PubChem CID 113427881) has the molecular formula C11H7Cl2NO4S
and a molecular weight of 320.15 g/mol. Its IUPAC name is 3,5-dichloro-4-(3,5-dioxothiomorpholin-4-yl)benzoic acid.
Molecular Properties
| Compound Name | 3,5-dichloro-4-(3,5-dioxothiomorpholin-4-yl)benzoic acid |
| PubChem CID | 113427881 |
| Molecular Formula | C11H7Cl2NO4S |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | 3,5-dichloro-4-(3,5-dioxothiomorpholin-4-yl)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(N2C(=O)CSCC2=O)c(Cl)c1 |
| InChI | InChI=1S/C11H7Cl2NO4S/c12-6-1-5(11(17)18)2-7(13)10(6)14-8(15)3-19-4-9(14)16/h1-2H,3-4H2,(H,17,18) |
| InChIKey | GWDHFARBINDJKV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-4-(3,5-dioxothiomorpholin-4-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-4-(3,5-dioxothiomorpholin-4-yl)benzoic acid?
The IUPAC name of 3,5-dichloro-4-(3,5-dioxothiomorpholin-4-yl)benzoic acid (CID 113427881) is 3,5-dichloro-4-(3,5-dioxothiomorpholin-4-yl)benzoic acid.
What is the SMILES notation for 3,5-dichloro-4-(3,5-dioxothiomorpholin-4-yl)benzoic acid?
The canonical SMILES for 3,5-dichloro-4-(3,5-dioxothiomorpholin-4-yl)benzoic acid is O=C(O)c1cc(Cl)c(N2C(=O)CSCC2=O)c(Cl)c1.
What is the InChIKey of 3,5-dichloro-4-(3,5-dioxothiomorpholin-4-yl)benzoic acid?
The InChIKey is GWDHFARBINDJKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Cl2NO4S/c12-6-1-5(11(17)18)2-7(13)10(6)14-8(15)3-19-4-9(14)16/h1-2H,3-4H2,(H,17,18).
What are the key properties of 3,5-dichloro-4-(3,5-dioxothiomorpholin-4-yl)benzoic acid?
3,5-dichloro-4-(3,5-dioxothiomorpholin-4-yl)benzoic acid has a molecular weight of 320.15 g/mol, XLogP of 2.30, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-4-(3,5-dioxothiomorpholin-4-yl)benzoic acid is sourced from PubChem (CID 113427881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).