C15H28N2 — CID 113428492
3-[(4-tert-butylcyclohexyl)methylamino]-2-methylpropanenitrile (PubChem CID 113428492) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 3-[(4-tert-butylcyclohexyl)methylamino]-2-methylpropanenitrile.
| Compound Name | 3-[(4-tert-butylcyclohexyl)methylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 113428492 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 3-[(4-tert-butylcyclohexyl)methylamino]-2-methylpropanenitrile |
| SMILES | CC(C#N)CNCC1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H28N2/c1-12(9-16)10-17-11-13-5-7-14(8-6-13)15(2,3)4/h12-14,17H,5-8,10-11H2,1-4H3 |
| InChIKey | JJMZSQSHSMMELI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |