C10H7N5O2S — CID 113428816
5-nitro-2-(1,3-thiazol-5-ylmethylamino)pyridine-3-carbonitrile (PubChem CID 113428816) has the molecular formula C10H7N5O2S and a molecular weight of 261.27 g/mol. Its IUPAC name is 5-nitro-2-(1,3-thiazol-5-ylmethylamino)pyridine-3-carbonitrile.
| Compound Name | 5-nitro-2-(1,3-thiazol-5-ylmethylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 113428816 |
| Molecular Formula | C10H7N5O2S |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 5-nitro-2-(1,3-thiazol-5-ylmethylamino)pyridine-3-carbonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])cnc1NCc1cncs1 |
| InChI | InChI=1S/C10H7N5O2S/c11-2-7-1-8(15(16)17)3-13-10(7)14-5-9-4-12-6-18-9/h1,3-4,6H,5H2,(H,13,14) |
| InChIKey | HHDNULQZVGECBX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|