C10H16F2N4O — CID 113429156
3-[[1-(difluoromethyl)imidazol-2-yl]methylamino]-3-methylbutanamide (PubChem CID 113429156) has the molecular formula C10H16F2N4O and a molecular weight of 246.26 g/mol. Its IUPAC name is 3-[[1-(difluoromethyl)imidazol-2-yl]methylamino]-3-methylbutanamide.
| Compound Name | 3-[[1-(difluoromethyl)imidazol-2-yl]methylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 113429156 |
| Molecular Formula | C10H16F2N4O |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 3-[[1-(difluoromethyl)imidazol-2-yl]methylamino]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)NCc1nccn1C(F)F |
| InChI | InChI=1S/C10H16F2N4O/c1-10(2,5-7(13)17)15-6-8-14-3-4-16(8)9(11)12/h3-4,9,15H,5-6H2,1-2H3,(H2,13,17) |
| InChIKey | QESMIBQIMAZQQU-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |