C33H46Cl3NO7Si — CID 11343004
[(2R,3S,4S,5R,6R)-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl] acetate (PubChem CID 11343004) has the molecular formula C33H46Cl3NO7Si and a molecular weight of 703.18 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 11343004 |
| Molecular Formula | C33H46Cl3NO7Si |
| Molecular Weight | 703.18 g/mol |
| Exact Mass | 701.21 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-4,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxy-6-[tri(propan-2-yl)silyloxymethyl]oxan-3-yl] acetate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C33H46Cl3NO7Si/c1-21(2)45(22(3)4,23(5)6)41-20-27-28(39-18-25-14-10-8-11-15-25)29(40-19-26-16-12-9-13-17-26)30(42-24(7)38)31(43-27)44-32(37)33(34,35)36/h8-17,21-23,27-31,37H,18-20H2,1-7H3/b37-32+/t27-,28-,29+,30+,31-/m1/s1 |
| InChIKey | PBHICSIJQZGEPN-YWPIKXLISA-N |
| XLogP | 8.37 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.18 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|