About 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-(1,2-oxazol-5-ylmethyl)acetamide
2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-(1,2-oxazol-5-ylmethyl)acetamide (PubChem CID 113431348) has the molecular formula C10H11N3O2S2
and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-(1,2-oxazol-5-ylmethyl)acetamide.
Molecular Properties
| Compound Name | 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-(1,2-oxazol-5-ylmethyl)acetamide |
| PubChem CID | 113431348 |
| Molecular Formula | C10H11N3O2S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-(1,2-oxazol-5-ylmethyl)acetamide |
| SMILES | Cc1[nH]c(=S)sc1CC(=O)NCc1ccno1 |
| InChI | InChI=1S/C10H11N3O2S2/c1-6-8(17-10(16)13-6)4-9(14)11-5-7-2-3-12-15-7/h2-3H,4-5H2,1H3,(H,11,14)(H,13,16) |
| InChIKey | DMPBSYGUNDOHIT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-(1,2-oxazol-5-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-(1,2-oxazol-5-ylmethyl)acetamide?
The IUPAC name of 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-(1,2-oxazol-5-ylmethyl)acetamide (CID 113431348) is 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-(1,2-oxazol-5-ylmethyl)acetamide.
What is the SMILES notation for 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-(1,2-oxazol-5-ylmethyl)acetamide?
The canonical SMILES for 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-(1,2-oxazol-5-ylmethyl)acetamide is Cc1[nH]c(=S)sc1CC(=O)NCc1ccno1.
What is the InChIKey of 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-(1,2-oxazol-5-ylmethyl)acetamide?
The InChIKey is DMPBSYGUNDOHIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2S2/c1-6-8(17-10(16)13-6)4-9(14)11-5-7-2-3-12-15-7/h2-3H,4-5H2,1H3,(H,11,14)(H,13,16).
What are the key properties of 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-(1,2-oxazol-5-ylmethyl)acetamide?
2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-(1,2-oxazol-5-ylmethyl)acetamide has a molecular weight of 269.35 g/mol, XLogP of 1.96, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-(1,2-oxazol-5-ylmethyl)acetamide is sourced from PubChem (CID 113431348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).