C12H13NO5 — CID 113431494
2-[2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl]benzoic acid (PubChem CID 113431494) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-[2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl]benzoic acid.
| Compound Name | 2-[2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 113431494 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-[2-[(2-methoxy-2-oxoethyl)amino]-2-oxoethyl]benzoic acid |
| SMILES | COC(=O)CNC(=O)Cc1ccccc1C(=O)O |
| InChI | InChI=1S/C12H13NO5/c1-18-11(15)7-13-10(14)6-8-4-2-3-5-9(8)12(16)17/h2-5H,6-7H2,1H3,(H,13,14)(H,16,17) |
| InChIKey | FZPOBCUXSSLVOP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |