C23H32NO4 — CID 11343194
CID 11343194 (PubChem CID 11343194) has the molecular formula C23H32NO4 and a molecular weight of 386.51 g/mol.
| Compound Name | CID 11343194 |
|---|---|
| PubChem CID | 11343194 |
| Molecular Formula | C23H32NO4 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | — |
| SMILES | CO[C@H]1[CH][CH][CH][C@@H](OC)N1C(=O)O[C@@H]1CCCC[C@H]1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H32NO4/c1-23(2,17-11-6-5-7-12-17)18-13-8-9-14-19(18)28-22(25)24-20(26-3)15-10-16-21(24)27-4/h5-7,10-12,15-16,18-21H,8-9,13-14H2,1-4H3/t18-,19-,20-,21+/m1/s1 |
| InChIKey | SXGFXGJENJJDOJ-NCYKPQTJSA-N |
| XLogP | 4.53 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |