About CID 11343194
CID 11343194 (PubChem CID 11343194) has the molecular formula C23H32NO4
and a molecular weight of 386.51 g/mol.
Molecular Properties
| Compound Name | CID 11343194 |
| PubChem CID | 11343194 |
| Molecular Formula | C23H32NO4 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | — |
| SMILES | CO[C@H]1[CH][CH][CH][C@@H](OC)N1C(=O)O[C@@H]1CCCC[C@H]1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H32NO4/c1-23(2,17-11-6-5-7-12-17)18-13-8-9-14-19(18)28-22(25)24-20(26-3)15-10-16-21(24)27-4/h5-7,10-12,15-16,18-21H,8-9,13-14H2,1-4H3/t18-,19-,20-,21+/m1/s1 |
| InChIKey | SXGFXGJENJJDOJ-NCYKPQTJSA-N |
| XLogP | 4.53 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 11343194 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11343194?
The IUPAC name of CID 11343194 (CID 11343194) is not available.
What is the SMILES notation for CID 11343194?
The canonical SMILES for CID 11343194 is CO[C@H]1[CH][CH][CH][C@@H](OC)N1C(=O)O[C@@H]1CCCC[C@H]1C(C)(C)c1ccccc1.
What is the InChIKey of CID 11343194?
The InChIKey is SXGFXGJENJJDOJ-NCYKPQTJSA-N. The full InChI is InChI=1S/C23H32NO4/c1-23(2,17-11-6-5-7-12-17)18-13-8-9-14-19(18)28-22(25)24-20(26-3)15-10-16-21(24)27-4/h5-7,10-12,15-16,18-21H,8-9,13-14H2,1-4H3/t18-,19-,20-,21+/m1/s1.
What are the key properties of CID 11343194?
CID 11343194 has a molecular weight of 386.51 g/mol, XLogP of 4.53, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11343194 is sourced from PubChem (CID 11343194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).