C36H26BF12N2O2- — CID 11343213
bis[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-bis[3,5-bis(trifluoromethyl)phenyl]boranuide (PubChem CID 11343213) has the molecular formula C36H26BF12N2O2- and a molecular weight of 757.40 g/mol. Its IUPAC name is bis[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-bis[3,5-bis(trifluoromethyl)phenyl]boranuide.
| Compound Name | bis[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-bis[3,5-bis(trifluoromethyl)phenyl]boranuide |
|---|---|
| PubChem CID | 11343213 |
| Molecular Formula | C36H26BF12N2O2- |
| Molecular Weight | 757.40 g/mol |
| Exact Mass | 757.19 |
| IUPAC Name | bis[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-bis[3,5-bis(trifluoromethyl)phenyl]boranuide |
| SMILES | FC(F)(F)c1cc([B-](C2=N[C@@H](Cc3ccccc3)CO2)(C2=N[C@@H](Cc3ccccc3)CO2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C36H26BF12N2O2/c38-33(39,40)23-13-24(34(41,42)43)16-27(15-23)37(31-50-29(19-52-31)11-21-7-3-1-4-8-21,32-51-30(20-53-32)12-22-9-5-2-6-10-22)28-17-25(35(44,45)46)14-26(18-28)36(47,48)49/h1-10,13-18,29-30H,11-12,19-20H2/q-1/t29-,30-/m0/s1 |
| InChIKey | AHVYVXOHOHHEFC-KYJUHHDHSA-N |
| XLogP | 8.48 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.40 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|