About 5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid
5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid (PubChem CID 113432528) has the molecular formula C12H14N2O5
and a molecular weight of 266.25 g/mol. Its IUPAC name is 5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid |
| PubChem CID | 113432528 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid |
| SMILES | CN1C(=O)CCC(NCc2cc(C(=O)O)co2)C1=O |
| InChI | InChI=1S/C12H14N2O5/c1-14-10(15)3-2-9(11(14)16)13-5-8-4-7(6-19-8)12(17)18/h4,6,9,13H,2-3,5H2,1H3,(H,17,18) |
| InChIKey | JXJAVLSXISNWHD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid?
The IUPAC name of 5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid (CID 113432528) is 5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid.
What is the SMILES notation for 5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid?
The canonical SMILES for 5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid is CN1C(=O)CCC(NCc2cc(C(=O)O)co2)C1=O.
What is the InChIKey of 5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid?
The InChIKey is JXJAVLSXISNWHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O5/c1-14-10(15)3-2-9(11(14)16)13-5-8-4-7(6-19-8)12(17)18/h4,6,9,13H,2-3,5H2,1H3,(H,17,18).
What are the key properties of 5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid?
5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid has a molecular weight of 266.25 g/mol, XLogP of 0.21, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid is sourced from PubChem (CID 113432528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).