C54H76NOP — CID 11343292
1-[(2S)-2-(diphenylphosphanylmethyl)-4,4-bis[[2,4,6-tri(propan-2-yl)phenyl]methyl]pyrrolidin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 11343292) has the molecular formula C54H76NOP and a molecular weight of 786.18 g/mol. Its IUPAC name is 1-[(2S)-2-(diphenylphosphanylmethyl)-4,4-bis[[2,4,6-tri(propan-2-yl)phenyl]methyl]pyrrolidin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(2S)-2-(diphenylphosphanylmethyl)-4,4-bis[[2,4,6-tri(propan-2-yl)phenyl]methyl]pyrrolidin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 11343292 |
| Molecular Formula | C54H76NOP |
| Molecular Weight | 786.18 g/mol |
| Exact Mass | 785.57 |
| IUPAC Name | 1-[(2S)-2-(diphenylphosphanylmethyl)-4,4-bis[[2,4,6-tri(propan-2-yl)phenyl]methyl]pyrrolidin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)c1cc(C(C)C)c(CC2(Cc3c(C(C)C)cc(C(C)C)cc3C(C)C)C[C@@H](CP(c3ccccc3)c3ccccc3)N(C(=O)C(C)(C)C)C2)c(C(C)C)c1 |
| InChI | InChI=1S/C54H76NOP/c1-35(2)41-26-46(37(5)6)50(47(27-41)38(7)8)31-54(32-51-48(39(9)10)28-42(36(3)4)29-49(51)40(11)12)30-43(55(34-54)52(56)53(13,14)15)33-57(44-22-18-16-19-23-44)45-24-20-17-21-25-45/h16-29,35-40,43H,30-34H2,1-15H3/t43-/m0/s1 |
| InChIKey | YBQZJIYJWRGTMH-QLKFWGTOSA-N |
| XLogP | 13.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.18 |
| LogP ≤ 5 | 13.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|