C14H22N2O — CID 113433012
1-[2-amino-5-[2,2-dimethylpropyl(methyl)amino]phenyl]ethanone (PubChem CID 113433012) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-[2-amino-5-[2,2-dimethylpropyl(methyl)amino]phenyl]ethanone.
| Compound Name | 1-[2-amino-5-[2,2-dimethylpropyl(methyl)amino]phenyl]ethanone |
|---|---|
| PubChem CID | 113433012 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 1-[2-amino-5-[2,2-dimethylpropyl(methyl)amino]phenyl]ethanone |
| SMILES | CC(=O)c1cc(N(C)CC(C)(C)C)ccc1N |
| InChI | InChI=1S/C14H22N2O/c1-10(17)12-8-11(6-7-13(12)15)16(5)9-14(2,3)4/h6-8H,9,15H2,1-5H3 |
| InChIKey | XLWLUSUBYYELGG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|