C50H46N8O2 — CID 11343304
2-N,9-N-bis[2-[acridin-9-ylmethyl(methyl)amino]ethyl]-2-N,9-N-dimethyl-1,10-phenanthroline-2,9-dicarboxamide (PubChem CID 11343304) has the molecular formula C50H46N8O2 and a molecular weight of 790.97 g/mol. Its IUPAC name is 2-N,9-N-bis[2-[acridin-9-ylmethyl(methyl)amino]ethyl]-2-N,9-N-dimethyl-1,10-phenanthroline-2,9-dicarboxamide.
| Compound Name | 2-N,9-N-bis[2-[acridin-9-ylmethyl(methyl)amino]ethyl]-2-N,9-N-dimethyl-1,10-phenanthroline-2,9-dicarboxamide |
|---|---|
| PubChem CID | 11343304 |
| Molecular Formula | C50H46N8O2 |
| Molecular Weight | 790.97 g/mol |
| Exact Mass | 790.37 |
| IUPAC Name | 2-N,9-N-bis[2-[acridin-9-ylmethyl(methyl)amino]ethyl]-2-N,9-N-dimethyl-1,10-phenanthroline-2,9-dicarboxamide |
| SMILES | CN(CCN(C)C(=O)c1ccc2ccc3ccc(C(=O)N(C)CCN(C)Cc4c5ccccc5nc5ccccc45)nc3c2n1)Cc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C50H46N8O2/c1-55(31-39-35-13-5-9-17-41(35)51-42-18-10-6-14-36(39)42)27-29-57(3)49(59)45-25-23-33-21-22-34-24-26-46(54-48(34)47(33)53-45)50(60)58(4)30-28-56(2)32-40-37-15-7-11-19-43(37)52-44-20-12-8-16-38(40)44/h5-26H,27-32H2,1-4H3 |
| InChIKey | KIXSWRVBKIQZRW-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 98.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.97 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|