C12H13N3O3 — CID 113433052
4-(3-acetyl-4-aminophenyl)piperazine-2,6-dione (PubChem CID 113433052) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 4-(3-acetyl-4-aminophenyl)piperazine-2,6-dione.
| Compound Name | 4-(3-acetyl-4-aminophenyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 113433052 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 4-(3-acetyl-4-aminophenyl)piperazine-2,6-dione |
| SMILES | CC(=O)c1cc(N2CC(=O)NC(=O)C2)ccc1N |
| InChI | InChI=1S/C12H13N3O3/c1-7(16)9-4-8(2-3-10(9)13)15-5-11(17)14-12(18)6-15/h2-4H,5-6,13H2,1H3,(H,14,17,18) |
| InChIKey | JLRKNFJBXFKLGJ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|