C13H17N3O — CID 113433939
5-cyclopentyl-3-ethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 113433939) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 5-cyclopentyl-3-ethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-cyclopentyl-3-ethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 113433939 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 5-cyclopentyl-3-ethyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCc1c[nH]n2c(=O)cc(C3CCCC3)nc12 |
| InChI | InChI=1S/C13H17N3O/c1-2-9-8-14-16-12(17)7-11(15-13(9)16)10-5-3-4-6-10/h7-8,10,14H,2-6H2,1H3 |
| InChIKey | RMIGOBKNAXKPHD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |