C10H16F3NO3 — CID 113435072
4,4,4-trifluoro-N-[4-(hydroxymethyl)oxan-4-yl]butanamide (PubChem CID 113435072) has the molecular formula C10H16F3NO3 and a molecular weight of 255.24 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[4-(hydroxymethyl)oxan-4-yl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[4-(hydroxymethyl)oxan-4-yl]butanamide |
|---|---|
| PubChem CID | 113435072 |
| Molecular Formula | C10H16F3NO3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 4,4,4-trifluoro-N-[4-(hydroxymethyl)oxan-4-yl]butanamide |
| SMILES | O=C(CCC(F)(F)F)NC1(CO)CCOCC1 |
| InChI | InChI=1S/C10H16F3NO3/c11-10(12,13)2-1-8(16)14-9(7-15)3-5-17-6-4-9/h15H,1-7H2,(H,14,16) |
| InChIKey | GNXOITPHMOOPKX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |